C13H15F3N4O5 — CID 140200251
[[1-(5-Methyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]carbamoylamino] 2,2,2-trifluoroacetate (PubChem CID 140200251) has the molecular formula C13H15F3N4O5 and a molecular weight of 364.28 g/mol. Its IUPAC name is [[1-(5-methyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]carbamoylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[1-(5-Methyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]carbamoylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140200251 |
| Molecular Formula | C13H15F3N4O5 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [[1-(5-methyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]carbamoylamino] 2,2,2-trifluoroacetate |
| SMILES | CC1=C(C=NO1)C(=O)N2CCC(CC2)NC(=O)NOC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N4O5/c1-7-9(6-17-24-7)10(21)20-4-2-8(3-5-20)18-12(23)19-25-11(22)13(14,15)16/h6,8H,2-5H2,1H3,(H2,18,19,23) |
| InChIKey | IBNHKVVAWTWTFJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | 522 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|