C23H36O5 — CID 14020115
4-O-[[(4aS,7R,8S,8aR)-4,7,8-trimethyl-8-(3-oxobutyl)-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate (PubChem CID 14020115) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is 4-O-[[(4aS,7R,8S,8aR)-4,7,8-trimethyl-8-(3-oxobutyl)-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[[(4aS,7R,8S,8aR)-4,7,8-trimethyl-8-(3-oxobutyl)-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 14020115 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 4-O-[[(4aS,7R,8S,8aR)-4,7,8-trimethyl-8-(3-oxobutyl)-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OC[C@@]12CC[C@@H](C)[C@](C)(CCC(C)=O)[C@H]1CCC=C2C |
| InChI | InChI=1S/C23H36O5/c1-16-11-14-23(15-28-21(26)10-9-20(25)27-5)17(2)7-6-8-19(23)22(16,4)13-12-18(3)24/h7,16,19H,6,8-15H2,1-5H3/t16-,19-,22+,23-/m1/s1 |
| InChIKey | PZMWBBAYOHYAOT-XHBDVGQISA-N |
| XLogP | 4.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|