About Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate
Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate (PubChem CID 140207181) has the molecular formula C10H10ClF2NO2
and a molecular weight of 249.64 g/mol. Its IUPAC name is ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate |
| PubChem CID | 140207181 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(C1=C(C=CC(=C1)Cl)N)(F)F |
| InChI | InChI=1S/C10H10ClF2NO2/c1-2-16-9(15)10(12,13)7-5-6(11)3-4-8(7)14/h3-5H,2,14H2,1H3 |
| InChIKey | JTYKYGJFHPBSRS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 263 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate?
The IUPAC name of Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate (CID 140207181) is ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate.
What is the SMILES notation for Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate?
The canonical SMILES for Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate is CCOC(=O)C(C1=C(C=CC(=C1)Cl)N)(F)F.
What is the InChIKey of Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate?
The InChIKey is JTYKYGJFHPBSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClF2NO2/c1-2-16-9(15)10(12,13)7-5-6(11)3-4-8(7)14/h3-5H,2,14H2,1H3.
What are the key properties of Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate?
Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate has a molecular weight of 249.64 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 2-(2-amino-5-chlorophenyl)-2,2-difluoroacetate is sourced from PubChem (CID 140207181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).