C18H24O3 — CID 14020749
(3S,5R)-5-[(4R,5R)-4,5-dimethyl-3-oxo-2,5,6,7-tetrahydro-1H-inden-4-yl]-3-ethenyl-3-methyloxolan-2-one (PubChem CID 14020749) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3S,5R)-5-[(4R,5R)-4,5-dimethyl-3-oxo-2,5,6,7-tetrahydro-1H-inden-4-yl]-3-ethenyl-3-methyloxolan-2-one.
| Compound Name | (3S,5R)-5-[(4R,5R)-4,5-dimethyl-3-oxo-2,5,6,7-tetrahydro-1H-inden-4-yl]-3-ethenyl-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 14020749 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (3S,5R)-5-[(4R,5R)-4,5-dimethyl-3-oxo-2,5,6,7-tetrahydro-1H-inden-4-yl]-3-ethenyl-3-methyloxolan-2-one |
| SMILES | C=C[C@]1(C)C[C@H]([C@@]2(C)C3=C(CCC3=O)CC[C@H]2C)OC1=O |
| InChI | InChI=1S/C18H24O3/c1-5-17(3)10-14(21-16(17)20)18(4)11(2)6-7-12-8-9-13(19)15(12)18/h5,11,14H,1,6-10H2,2-4H3/t11-,14-,17-,18+/m1/s1 |
| InChIKey | QOFFHGNEJBQKRF-DGWLBADLSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|