C19H24O6 — CID 14021345
[(6E,9S,10E,11aR)-9-acetyloxy-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-3-yl]methyl acetate (PubChem CID 14021345) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(6E,9S,10E,11aR)-9-acetyloxy-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-3-yl]methyl acetate.
| Compound Name | [(6E,9S,10E,11aR)-9-acetyloxy-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 14021345 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(6E,9S,10E,11aR)-9-acetyloxy-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C2CC/C(C)=C/C[C@H](OC(C)=O)/C(C)=C/[C@H]2OC1=O |
| InChI | InChI=1S/C19H24O6/c1-11-5-7-15-16(10-23-13(3)20)19(22)25-18(15)9-12(2)17(8-6-11)24-14(4)21/h6,9,17-18H,5,7-8,10H2,1-4H3/b11-6+,12-9+/t17-,18+/m0/s1 |
| InChIKey | REPWVCQYJWEGRA-IHGGHRHVSA-N |
| XLogP | 2.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|