C22H30O9 — CID 14021439
[(1S,2R,4S,5R,6S,9S,10S,11S,12S,13R)-12-acetyloxy-2,11-dihydroxy-2,6,11-trimethyl-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 14021439) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6S,9S,10S,11S,12S,13R)-12-acetyloxy-2,11-dihydroxy-2,6,11-trimethyl-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,2R,4S,5R,6S,9S,10S,11S,12S,13R)-12-acetyloxy-2,11-dihydroxy-2,6,11-trimethyl-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 14021439 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [(1S,2R,4S,5R,6S,9S,10S,11S,12S,13R)-12-acetyloxy-2,11-dihydroxy-2,6,11-trimethyl-7-oxo-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C[C@@](C)(O)[C@@]23O[C@@H]2[C@H](OC(C)=O)[C@@](C)(O)[C@@H]3[C@H]2OC(=O)[C@@H](C)[C@@H]21 |
| InChI | InChI=1S/C22H30O9/c1-7-9(2)18(24)29-12-8-20(5,26)22-15(14-13(12)10(3)19(25)30-14)21(6,27)16(17(22)31-22)28-11(4)23/h7,10,12-17,26-27H,8H2,1-6H3/b9-7-/t10-,12-,13+,14-,15-,16-,17+,20+,21-,22-/m0/s1 |
| InChIKey | KGJXPQCLJJWERC-RNRHJGKRSA-N |
| XLogP | 0.65 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|