C23H34O9 — CID 14021620
tetramethyl (4E,10E,12E)-14-hydroxy-5-methyltetradeca-4,10,12-triene-1,1,8,8-tetracarboxylate (PubChem CID 14021620) has the molecular formula C23H34O9 and a molecular weight of 454.52 g/mol. Its IUPAC name is tetramethyl (4E,10E,12E)-14-hydroxy-5-methyltetradeca-4,10,12-triene-1,1,8,8-tetracarboxylate.
| Compound Name | tetramethyl (4E,10E,12E)-14-hydroxy-5-methyltetradeca-4,10,12-triene-1,1,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 14021620 |
| Molecular Formula | C23H34O9 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | tetramethyl (4E,10E,12E)-14-hydroxy-5-methyltetradeca-4,10,12-triene-1,1,8,8-tetracarboxylate |
| SMILES | COC(=O)C(CC/C=C(\C)CCC(C/C=C/C=C/CO)(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C23H34O9/c1-17(11-10-12-18(19(25)29-2)20(26)30-3)13-15-23(21(27)31-4,22(28)32-5)14-8-6-7-9-16-24/h6-9,11,18,24H,10,12-16H2,1-5H3/b8-6+,9-7+,17-11+ |
| InChIKey | MZSKCONBTBTXQF-SQWNNYKZSA-N |
| XLogP | 2.28 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|