C23H32O8 — CID 14021645
tetramethyl (3E,5E,11Z)-11-methylcyclotetradeca-3,5,11-triene-1,1,8,8-tetracarboxylate (PubChem CID 14021645) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is tetramethyl (3E,5E,11Z)-11-methylcyclotetradeca-3,5,11-triene-1,1,8,8-tetracarboxylate.
| Compound Name | tetramethyl (3E,5E,11Z)-11-methylcyclotetradeca-3,5,11-triene-1,1,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 14021645 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tetramethyl (3E,5E,11Z)-11-methylcyclotetradeca-3,5,11-triene-1,1,8,8-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C=C/C=C/CC(C(=O)OC)(C(=O)OC)CC/C(C)=C\CC1 |
| InChI | InChI=1S/C23H32O8/c1-17-11-10-15-22(18(24)28-2,19(25)29-3)13-8-6-7-9-14-23(16-12-17,20(26)30-4)21(27)31-5/h6-9,11H,10,12-16H2,1-5H3/b8-6+,9-7+,17-11- |
| InChIKey | RDNUWAQOLRKBFQ-WCPZEKIOSA-N |
| XLogP | 3.06 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|