C20H14O2 — CID 14022175
(4R,5R)-4,5-dihydrobenzo[k]fluoranthene-4,5-diol (PubChem CID 14022175) has the molecular formula C20H14O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is (4R,5R)-4,5-dihydrobenzo[k]fluoranthene-4,5-diol.
| Compound Name | (4R,5R)-4,5-dihydrobenzo[k]fluoranthene-4,5-diol |
|---|---|
| PubChem CID | 14022175 |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (4R,5R)-4,5-dihydrobenzo[k]fluoranthene-4,5-diol |
| SMILES | O[C@@H]1C=C2c3cc4ccccc4cc3-c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C20H14O2/c21-18-10-17-16-9-12-5-2-1-4-11(12)8-15(16)13-6-3-7-14(19(13)17)20(18)22/h1-10,18,20-22H/t18-,20-/m1/s1 |
| InChIKey | OFEOEMYUJQKIRD-UYAOXDASSA-N |
| XLogP | 3.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |