About 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate
1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate (PubChem CID 14022851) has the molecular formula C16H22N4O3
and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate.
Molecular Properties
| Compound Name | 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate |
| PubChem CID | 14022851 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate |
| SMILES | N#[N+]c1c([O-])n(C2CCCCC2)c(=O)n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C16H22N4O3/c17-18-13-14(21)19(11-7-3-1-4-8-11)16(23)20(15(13)22)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | NQYOXPXTHYGCNA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate?
The IUPAC name of 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate (CID 14022851) is 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate.
What is the SMILES notation for 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate?
The canonical SMILES for 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate is N#[N+]c1c([O-])n(C2CCCCC2)c(=O)n(C2CCCCC2)c1=O.
What is the InChIKey of 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate?
The InChIKey is NQYOXPXTHYGCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O3/c17-18-13-14(21)19(11-7-3-1-4-8-11)16(23)20(15(13)22)12-9-5-2-6-10-12/h11-12H,1-10H2.
What are the key properties of 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate?
1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate has a molecular weight of 318.38 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexyl-5-diazonio-2,6-dioxopyrimidin-4-olate is sourced from PubChem (CID 14022851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).