C13H13N5S — CID 14022913
2-methyl-4-methylsulfanyl-6-(pyridin-3-ylmethylamino)pyrimidine-5-carbonitrile (PubChem CID 14022913) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-methyl-4-methylsulfanyl-6-(pyridin-3-ylmethylamino)pyrimidine-5-carbonitrile.
| Compound Name | 2-methyl-4-methylsulfanyl-6-(pyridin-3-ylmethylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 14022913 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-methyl-4-methylsulfanyl-6-(pyridin-3-ylmethylamino)pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(C)nc(NCc2cccnc2)c1C#N |
| InChI | InChI=1S/C13H13N5S/c1-9-17-12(11(6-14)13(18-9)19-2)16-8-10-4-3-5-15-7-10/h3-5,7H,8H2,1-2H3,(H,16,17,18) |
| InChIKey | ACTVIRMTINZEBI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |