C7H2F10 — CID 14023041
1-(difluoromethyl)-3,3,4,4,5,5,6,6-octafluorocyclohexene (PubChem CID 14023041) has the molecular formula C7H2F10 and a molecular weight of 276.07 g/mol. Its IUPAC name is 1-(difluoromethyl)-3,3,4,4,5,5,6,6-octafluorocyclohexene.
| Compound Name | 1-(difluoromethyl)-3,3,4,4,5,5,6,6-octafluorocyclohexene |
|---|---|
| PubChem CID | 14023041 |
| Molecular Formula | C7H2F10 |
| Molecular Weight | 276.07 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 1-(difluoromethyl)-3,3,4,4,5,5,6,6-octafluorocyclohexene |
| SMILES | FC(F)C1=CC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H2F10/c8-3(9)2-1-4(10,11)6(14,15)7(16,17)5(2,12)13/h1,3H |
| InChIKey | DKYOQEXIIPYKMD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.07 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|