C7HF11 — CID 14023042
3,3,4,4,5,5,6,6-octafluoro-1-(trifluoromethyl)cyclohexene (PubChem CID 14023042) has the molecular formula C7HF11 and a molecular weight of 294.06 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-1-(trifluoromethyl)cyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-1-(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 14023042 |
| Molecular Formula | C7HF11 |
| Molecular Weight | 294.06 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-1-(trifluoromethyl)cyclohexene |
| SMILES | FC(F)(F)C1=CC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7HF11/c8-3(9)1-2(5(12,13)14)4(10,11)7(17,18)6(3,15)16/h1H |
| InChIKey | PMZTYRFHQHVXBJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.06 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|