C12H16O4 — CID 14023124
dimethyl 2-[(1E,3E)-penta-1,3-dienyl]cyclopropane-1,1-dicarboxylate (PubChem CID 14023124) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is dimethyl 2-[(1E,3E)-penta-1,3-dienyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[(1E,3E)-penta-1,3-dienyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 14023124 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | dimethyl 2-[(1E,3E)-penta-1,3-dienyl]cyclopropane-1,1-dicarboxylate |
| SMILES | C/C=C/C=C/C1CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H16O4/c1-4-5-6-7-9-8-12(9,10(13)15-2)11(14)16-3/h4-7,9H,8H2,1-3H3/b5-4+,7-6+ |
| InChIKey | JJCMDTKKFBSMST-YTXTXJHMSA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|