C17H9F21 — CID 14024090
5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 14024090) has the molecular formula C17H9F21 and a molecular weight of 612.22 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 14024090 |
| Molecular Formula | C17H9F21 |
| Molecular Weight | 612.22 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C17H9F21/c18-8(19,7-4-5-1-2-6(7)3-5)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)16(34,35)17(36,37)38/h1-2,5-7H,3-4H2 |
| InChIKey | USPUTRRFKSYNFN-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.22 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|