C15H8F18 — CID 14024092
5,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 14024092) has the molecular formula C15H8F18 and a molecular weight of 530.19 g/mol. Its IUPAC name is 5,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 14024092 |
| Molecular Formula | C15H8F18 |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 5,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1C2C=CC(C2)C1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H8F18/c16-8(17,10(20,21)12(24,25)14(28,29)30)6-4-1-2-5(3-4)7(6)9(18,19)11(22,23)13(26,27)15(31,32)33/h1-2,4-7H,3H2 |
| InChIKey | FCGUWOBMUDCVFI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|