C11H21BNNaSi — CID 14024396
sodium 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1-azanida-2-sila-5-boracyclopent-3-ene (PubChem CID 14024396) has the molecular formula C11H21BNNaSi and a molecular weight of 229.18 g/mol. Its IUPAC name is sodium 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1-azanida-2-sila-5-boracyclopent-3-ene.
| Compound Name | sodium 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1-azanida-2-sila-5-boracyclopent-3-ene |
|---|---|
| PubChem CID | 14024396 |
| Molecular Formula | C11H21BNNaSi |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | sodium 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1-azanida-2-sila-5-boracyclopent-3-ene |
| SMILES | C=C(C)C1=C(CC)B(CC)[N-][Si]1(C)C.[Na+] |
| InChI | InChI=1S/C11H21BNSi.Na/c1-7-10-11(9(3)4)14(5,6)13-12(10)8-2;/h3,7-8H2,1-2,4-6H3;/q-1;+1 |
| InChIKey | AVPULZHCUKNBBJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|