C11H22BNSi — CID 14024397
4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1H-1,2,5-azasilaborole (PubChem CID 14024397) has the molecular formula C11H22BNSi and a molecular weight of 207.20 g/mol. Its IUPAC name is 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1H-1,2,5-azasilaborole.
| Compound Name | 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1H-1,2,5-azasilaborole |
|---|---|
| PubChem CID | 14024397 |
| Molecular Formula | C11H22BNSi |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1H-1,2,5-azasilaborole |
| SMILES | C=C(C)C1=C(CC)B(CC)N[Si]1(C)C |
| InChI | InChI=1S/C11H22BNSi/c1-7-10-11(9(3)4)14(5,6)13-12(10)8-2/h13H,3,7-8H2,1-2,4-6H3 |
| InChIKey | DZWBEDOAVOSYFJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|