C9H19BO3Si — CID 14024412
2-ethoxy-6-ethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine (PubChem CID 14024412) has the molecular formula C9H19BO3Si and a molecular weight of 214.15 g/mol. Its IUPAC name is 2-ethoxy-6-ethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine.
| Compound Name | 2-ethoxy-6-ethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine |
|---|---|
| PubChem CID | 14024412 |
| Molecular Formula | C9H19BO3Si |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-ethoxy-6-ethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine |
| SMILES | CCOB1OC(CC)=C(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C9H19BO3Si/c1-6-9-8(3)14(4,5)13-10(12-9)11-7-2/h6-7H2,1-5H3 |
| InChIKey | NIWLHCHINUJBIM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|