1-acetyl-2,3-dihydroindole-5-sulfonyl chloride

C10H10ClNO3S — CID 14024596

IUPAC1-acetyl-2,3-dihydroindole-5-sulfonyl chloride
SMILESCC(=O)N1CCc2cc(S(=O)(=O)Cl)ccc21
InChIInChI=1S/C10H10ClNO3S/c1-7(13)12-5-4-8-6-9(16(11,14)15)2-3-10(8)12/h2-3,6H,4-5H2,1H3
InChIKeyQNFXLCHANYHGIF-UHFFFAOYSA-N
MW259.71 g/mol
LogP1.52
Rot. Bonds1

About 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride

1-acetyl-2,3-dihydroindole-5-sulfonyl chloride (PubChem CID 14024596) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride.

Molecular Properties

Compound Name1-acetyl-2,3-dihydroindole-5-sulfonyl chloride
PubChem CID14024596
Molecular FormulaC10H10ClNO3S
Molecular Weight259.71 g/mol
Exact Mass259.01
IUPAC Name1-acetyl-2,3-dihydroindole-5-sulfonyl chloride
SMILESCC(=O)N1CCc2cc(S(=O)(=O)Cl)ccc21
InChIInChI=1S/C10H10ClNO3S/c1-7(13)12-5-4-8-6-9(16(11,14)15)2-3-10(8)12/h2-3,6H,4-5H2,1H3
InChIKeyQNFXLCHANYHGIF-UHFFFAOYSA-N
XLogP1.52
TPSA54.45 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.71
LogP ≤ 51.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride?
The IUPAC name of 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride (CID 14024596) is 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride.
What is the SMILES notation for 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride?
The canonical SMILES for 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride is CC(=O)N1CCc2cc(S(=O)(=O)Cl)ccc21.
What is the InChIKey of 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride?
The InChIKey is QNFXLCHANYHGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO3S/c1-7(13)12-5-4-8-6-9(16(11,14)15)2-3-10(8)12/h2-3,6H,4-5H2,1H3.
What are the key properties of 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride?
1-acetyl-2,3-dihydroindole-5-sulfonyl chloride has a molecular weight of 259.71 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2,3-dihydroindole-5-sulfonyl chloride is sourced from PubChem (CID 14024596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).