C5F5+ — CID 14024640
1,2,3,4,5-pentafluorocyclopenta-1,3-diene (PubChem CID 14024640) has the molecular formula C5F5+ and a molecular weight of 155.04 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluorocyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5-pentafluorocyclopenta-1,3-diene |
|---|---|
| PubChem CID | 14024640 |
| Molecular Formula | C5F5+ |
| Molecular Weight | 155.04 g/mol |
| Exact Mass | 154.99 |
| IUPAC Name | 1,2,3,4,5-pentafluorocyclopenta-1,3-diene |
| SMILES | FC1=C(F)[C+](F)C(F)=C1F |
| InChI | InChI=1S/C5F5/c6-1-2(7)4(9)5(10)3(1)8/q+1 |
| InChIKey | LVIVRWIINPTMTJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.04 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|