C16H18N2S — CID 14024666
1-N,1-N,9-N,9-N-tetramethyldibenzothiophene-1,9-diamine (PubChem CID 14024666) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 1-N,1-N,9-N,9-N-tetramethyldibenzothiophene-1,9-diamine.
| Compound Name | 1-N,1-N,9-N,9-N-tetramethyldibenzothiophene-1,9-diamine |
|---|---|
| PubChem CID | 14024666 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-N,1-N,9-N,9-N-tetramethyldibenzothiophene-1,9-diamine |
| SMILES | CN(C)c1cccc2sc3cccc(N(C)C)c3c12 |
| InChI | InChI=1S/C16H18N2S/c1-17(2)11-7-5-9-13-15(11)16-12(18(3)4)8-6-10-14(16)19-13/h5-10H,1-4H3 |
| InChIKey | BENSVOMKPWCOFF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |