About [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate
[2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate (PubChem CID 14024673) has the molecular formula C9H10O6
and a molecular weight of 214.17 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate.
Molecular Properties
| Compound Name | [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate |
| PubChem CID | 14024673 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate |
| SMILES | CC(=O)OC1(C2OCCO2)C=CC(=O)O1 |
| InChI | InChI=1S/C9H10O6/c1-6(10)14-9(3-2-7(11)15-9)8-12-4-5-13-8/h2-3,8H,4-5H2,1H3 |
| InChIKey | ZTFIDNLFBAZPMV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate?
The IUPAC name of [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate (CID 14024673) is [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate.
What is the SMILES notation for [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate?
The canonical SMILES for [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate is CC(=O)OC1(C2OCCO2)C=CC(=O)O1.
What is the InChIKey of [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate?
The InChIKey is ZTFIDNLFBAZPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O6/c1-6(10)14-9(3-2-7(11)15-9)8-12-4-5-13-8/h2-3,8H,4-5H2,1H3.
What are the key properties of [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate?
[2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate has a molecular weight of 214.17 g/mol, XLogP of -0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxolan-2-yl)-5-oxofuran-2-yl] acetate is sourced from PubChem (CID 14024673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).