About 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one
6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 14025021) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
Molecular Properties
| Compound Name | 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| PubChem CID | 14025021 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | CC1=CC(=O)C=CC12OCCO2 |
| InChI | InChI=1S/C9H10O3/c1-7-6-8(10)2-3-9(7)11-4-5-12-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | CXWYRKAGPDRVQF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (CID 14025021) is 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is CC1=CC(=O)C=CC12OCCO2.
What is the InChIKey of 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is CXWYRKAGPDRVQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-7-6-8(10)2-3-9(7)11-4-5-12-9/h2-3,6H,4-5H2,1H3.
What are the key properties of 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 166.18 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 14025021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).