C12H19N — CID 14025646
N-ethyl-1-(2-methylphenyl)propan-2-amine (PubChem CID 14025646) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-ethyl-1-(2-methylphenyl)propan-2-amine.
| Compound Name | N-ethyl-1-(2-methylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 14025646 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-ethyl-1-(2-methylphenyl)propan-2-amine |
| SMILES | CCNC(C)Cc1ccccc1C |
| InChI | InChI=1S/C12H19N/c1-4-13-11(3)9-12-8-6-5-7-10(12)2/h5-8,11,13H,4,9H2,1-3H3 |
| InChIKey | VADMZSPWSTVILN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |