C10H11N — CID 14025669
4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene (PubChem CID 14025669) has the molecular formula C10H11N and a molecular weight of 145.21 g/mol. Its IUPAC name is 4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene.
| Compound Name | 4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene |
|---|---|
| PubChem CID | 14025669 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene |
| SMILES | C1=CC2CCC1c1c[nH]cc12 |
| InChI | InChI=1S/C10H11N/c1-2-8-4-3-7(1)9-5-11-6-10(8)9/h1-2,5-8,11H,3-4H2 |
| InChIKey | BGBOHYIXUAXBRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|