About 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine
2,2-dimethyl-1,4-dihydro-3,1-benzoxazine (PubChem CID 14025914) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine |
| PubChem CID | 14025914 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine |
| SMILES | CC1(C)Nc2ccccc2CO1 |
| InChI | InChI=1S/C10H13NO/c1-10(2)11-9-6-4-3-5-8(9)7-12-10/h3-6,11H,7H2,1-2H3 |
| InChIKey | MAEQOIDZBKIVHI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine?
The IUPAC name of 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine (CID 14025914) is 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine.
What is the SMILES notation for 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine?
The canonical SMILES for 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine is CC1(C)Nc2ccccc2CO1.
What is the InChIKey of 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine?
The InChIKey is MAEQOIDZBKIVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-10(2)11-9-6-4-3-5-8(9)7-12-10/h3-6,11H,7H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine?
2,2-dimethyl-1,4-dihydro-3,1-benzoxazine has a molecular weight of 163.22 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,4-dihydro-3,1-benzoxazine is sourced from PubChem (CID 14025914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).