C9H10F9I — CID 14026612
1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methyloctane (PubChem CID 14026612) has the molecular formula C9H10F9I and a molecular weight of 416.07 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methyloctane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methyloctane |
|---|---|
| PubChem CID | 14026612 |
| Molecular Formula | C9H10F9I |
| Molecular Weight | 416.07 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methyloctane |
| SMILES | CCC(C)(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9I/c1-3-5(2,19)4-6(10,11)7(12,13)8(14,15)9(16,17)18/h3-4H2,1-2H3 |
| InChIKey | MCQHQDVQWROECQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.07 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|