C11H10F13I — CID 14026613
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo-8-methyldecane (PubChem CID 14026613) has the molecular formula C11H10F13I and a molecular weight of 516.08 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo-8-methyldecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo-8-methyldecane |
|---|---|
| PubChem CID | 14026613 |
| Molecular Formula | C11H10F13I |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.96 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo-8-methyldecane |
| SMILES | CCC(C)(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F13I/c1-3-5(2,25)4-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h3-4H2,1-2H3 |
| InChIKey | RDJRPIAWDYOSQS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|