C16H16N6O2S — CID 1402670
6-(2,5-dimethoxyphenyl)-3-(5-methyl-1H-pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 1402670) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-3-(5-methyl-1H-pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(2,5-dimethoxyphenyl)-3-(5-methyl-1H-pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 1402670 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-3-(5-methyl-1H-pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | COc1ccc(OC)c(C2=Nn3c(nnc3-c3cc(C)[nH]n3)SC2)c1 |
| InChI | InChI=1S/C16H16N6O2S/c1-9-6-12(18-17-9)15-19-20-16-22(15)21-13(8-25-16)11-7-10(23-2)4-5-14(11)24-3/h4-7H,8H2,1-3H3,(H,17,18) |
| InChIKey | BDLWBVGWNXZNSU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |