About 3,4,5-trimethyl-3H-pyran-2,6-dione
3,4,5-trimethyl-3H-pyran-2,6-dione (PubChem CID 14026948) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3,4,5-trimethyl-3H-pyran-2,6-dione.
Molecular Properties
| Compound Name | 3,4,5-trimethyl-3H-pyran-2,6-dione |
| PubChem CID | 14026948 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3,4,5-trimethyl-3H-pyran-2,6-dione |
| SMILES | CC1=C(C)C(C)C(=O)OC1=O |
| InChI | InChI=1S/C8H10O3/c1-4-5(2)7(9)11-8(10)6(4)3/h5H,1-3H3 |
| InChIKey | XSEKLIDLTOGLTM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trimethyl-3H-pyran-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethyl-3H-pyran-2,6-dione?
The IUPAC name of 3,4,5-trimethyl-3H-pyran-2,6-dione (CID 14026948) is 3,4,5-trimethyl-3H-pyran-2,6-dione.
What is the SMILES notation for 3,4,5-trimethyl-3H-pyran-2,6-dione?
The canonical SMILES for 3,4,5-trimethyl-3H-pyran-2,6-dione is CC1=C(C)C(C)C(=O)OC1=O.
What is the InChIKey of 3,4,5-trimethyl-3H-pyran-2,6-dione?
The InChIKey is XSEKLIDLTOGLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-4-5(2)7(9)11-8(10)6(4)3/h5H,1-3H3.
What are the key properties of 3,4,5-trimethyl-3H-pyran-2,6-dione?
3,4,5-trimethyl-3H-pyran-2,6-dione has a molecular weight of 154.16 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethyl-3H-pyran-2,6-dione is sourced from PubChem (CID 14026948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).