About 3-(dichloromethyl)-2,2-dimethyloxane
3-(dichloromethyl)-2,2-dimethyloxane (PubChem CID 14027502) has the molecular formula C8H14Cl2O
and a molecular weight of 197.10 g/mol. Its IUPAC name is 3-(dichloromethyl)-2,2-dimethyloxane.
Molecular Properties
| Compound Name | 3-(dichloromethyl)-2,2-dimethyloxane |
| PubChem CID | 14027502 |
| Molecular Formula | C8H14Cl2O |
| Molecular Weight | 197.10 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 3-(dichloromethyl)-2,2-dimethyloxane |
| SMILES | CC1(C)OCCCC1C(Cl)Cl |
| InChI | InChI=1S/C8H14Cl2O/c1-8(2)6(7(9)10)4-3-5-11-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | GJVWJGOOLCDKTD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(dichloromethyl)-2,2-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dichloromethyl)-2,2-dimethyloxane?
The IUPAC name of 3-(dichloromethyl)-2,2-dimethyloxane (CID 14027502) is 3-(dichloromethyl)-2,2-dimethyloxane.
What is the SMILES notation for 3-(dichloromethyl)-2,2-dimethyloxane?
The canonical SMILES for 3-(dichloromethyl)-2,2-dimethyloxane is CC1(C)OCCCC1C(Cl)Cl.
What is the InChIKey of 3-(dichloromethyl)-2,2-dimethyloxane?
The InChIKey is GJVWJGOOLCDKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2O/c1-8(2)6(7(9)10)4-3-5-11-8/h6-7H,3-5H2,1-2H3.
What are the key properties of 3-(dichloromethyl)-2,2-dimethyloxane?
3-(dichloromethyl)-2,2-dimethyloxane has a molecular weight of 197.10 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dichloromethyl)-2,2-dimethyloxane is sourced from PubChem (CID 14027502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).