C11H15N — CID 14027805
3-ethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 14027805) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-ethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-ethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 14027805 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-ethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCC1Cc2ccccc2CN1 |
| InChI | InChI=1S/C11H15N/c1-2-11-7-9-5-3-4-6-10(9)8-12-11/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | DQJWABGLXUIRKS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |