About 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate
5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate (PubChem CID 1402799) has the molecular formula C14H17N2O4-
and a molecular weight of 277.30 g/mol. Its IUPAC name is 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate.
Molecular Properties
| Compound Name | 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate |
| PubChem CID | 1402799 |
| Molecular Formula | C14H17N2O4- |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate |
| SMILES | CC(=O)c1c([O-])n(CCC2=CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H18N2O4/c1-9(17)11-12(18)15-14(20)16(13(11)19)8-7-10-5-3-2-4-6-10/h5,19H,2-4,6-8H2,1H3,(H,15,18,20)/p-1 |
| InChIKey | VDFAZYZWWWRODB-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate?
The IUPAC name of 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate (CID 1402799) is 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate.
What is the SMILES notation for 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate?
The canonical SMILES for 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate is CC(=O)c1c([O-])n(CCC2=CCCCC2)c(=O)[nH]c1=O.
What is the InChIKey of 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate?
The InChIKey is VDFAZYZWWWRODB-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H18N2O4/c1-9(17)11-12(18)15-14(20)16(13(11)19)8-7-10-5-3-2-4-6-10/h5,19H,2-4,6-8H2,1H3,(H,15,18,20)/p-1.
What are the key properties of 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate?
5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate has a molecular weight of 277.30 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3-[2-(cyclohexen-1-yl)ethyl]-2,6-dioxopyrimidin-4-olate is sourced from PubChem (CID 1402799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).