C7H5ClF8 — CID 14028188
7-chloro-4,4,5,5,6,6,7,7-octafluorohept-1-ene (PubChem CID 14028188) has the molecular formula C7H5ClF8 and a molecular weight of 276.55 g/mol. Its IUPAC name is 7-chloro-4,4,5,5,6,6,7,7-octafluorohept-1-ene.
| Compound Name | 7-chloro-4,4,5,5,6,6,7,7-octafluorohept-1-ene |
|---|---|
| PubChem CID | 14028188 |
| Molecular Formula | C7H5ClF8 |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 7-chloro-4,4,5,5,6,6,7,7-octafluorohept-1-ene |
| SMILES | C=CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C7H5ClF8/c1-2-3-4(9,10)5(11,12)6(13,14)7(8,15)16/h2H,1,3H2 |
| InChIKey | GRIAUKXSYPCIJU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|