C7H10F5I — CID 14028189
1,1,1,2,2-pentafluoro-4-iodo-4-methylhexane (PubChem CID 14028189) has the molecular formula C7H10F5I and a molecular weight of 316.05 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-4-iodo-4-methylhexane.
| Compound Name | 1,1,1,2,2-pentafluoro-4-iodo-4-methylhexane |
|---|---|
| PubChem CID | 14028189 |
| Molecular Formula | C7H10F5I |
| Molecular Weight | 316.05 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-4-iodo-4-methylhexane |
| SMILES | CCC(C)(I)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5I/c1-3-5(2,13)4-6(8,9)7(10,11)12/h3-4H2,1-2H3 |
| InChIKey | ZKJOCHQBUXOTPG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|