C10H16Si2 — CID 14028747
7,7,8,8-tetramethyl-7,8-disilabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 14028747) has the molecular formula C10H16Si2 and a molecular weight of 192.41 g/mol. Its IUPAC name is 7,7,8,8-tetramethyl-7,8-disilabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7,7,8,8-tetramethyl-7,8-disilabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 14028747 |
| Molecular Formula | C10H16Si2 |
| Molecular Weight | 192.41 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 7,7,8,8-tetramethyl-7,8-disilabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | C[Si]1(C)c2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C10H16Si2/c1-11(2)9-7-5-6-8-10(9)12(11,3)4/h5-8H,1-4H3 |
| InChIKey | GIQIBOUNUSDZEZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|