About dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate
dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate (PubChem CID 14029271) has the molecular formula C15H24F3NO5
and a molecular weight of 355.35 g/mol. Its IUPAC name is dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate.
Molecular Properties
| Compound Name | dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate |
| PubChem CID | 14029271 |
| Molecular Formula | C15H24F3NO5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate |
| SMILES | CCCCOC(=O)CC[C@H](NC(=O)C(F)(F)F)C(=O)OCCCC |
| InChI | InChI=1S/C15H24F3NO5/c1-3-5-9-23-12(20)8-7-11(13(21)24-10-6-4-2)19-14(22)15(16,17)18/h11H,3-10H2,1-2H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | YVLATHFLIIDMDU-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate?
The IUPAC name of dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate (CID 14029271) is dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate.
What is the SMILES notation for dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate?
The canonical SMILES for dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate is CCCCOC(=O)CC[C@H](NC(=O)C(F)(F)F)C(=O)OCCCC.
What is the InChIKey of dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate?
The InChIKey is YVLATHFLIIDMDU-NSHDSACASA-N. The full InChI is InChI=1S/C15H24F3NO5/c1-3-5-9-23-12(20)8-7-11(13(21)24-10-6-4-2)19-14(22)15(16,17)18/h11H,3-10H2,1-2H3,(H,19,22)/t11-/m0/s1.
What are the key properties of dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate?
dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate has a molecular weight of 355.35 g/mol, XLogP of 2.50, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pentanedioate is sourced from PubChem (CID 14029271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).