C6H2Br2Cl2 — CID 14029667
1,3-dibromo-2,5-dichlorobenzene (PubChem CID 14029667) has the molecular formula C6H2Br2Cl2 and a molecular weight of 304.80 g/mol. Its IUPAC name is 1,3-dibromo-2,5-dichlorobenzene.
| Compound Name | 1,3-dibromo-2,5-dichlorobenzene |
|---|---|
| PubChem CID | 14029667 |
| Molecular Formula | C6H2Br2Cl2 |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 301.79 |
| IUPAC Name | 1,3-dibromo-2,5-dichlorobenzene |
| SMILES | Clc1cc(Br)c(Cl)c(Br)c1 |
| InChI | InChI=1S/C6H2Br2Cl2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| InChIKey | HKKSDHKJUSSWAI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|