C4H13N3 — CID 14029763
2-N-ethylethane-1,1,2-triamine (PubChem CID 14029763) has the molecular formula C4H13N3 and a molecular weight of 103.17 g/mol. Its IUPAC name is 2-N-ethylethane-1,1,2-triamine.
| Compound Name | 2-N-ethylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 14029763 |
| Molecular Formula | C4H13N3 |
| Molecular Weight | 103.17 g/mol |
| Exact Mass | 103.11 |
| IUPAC Name | 2-N-ethylethane-1,1,2-triamine |
| SMILES | CCNCC(N)N |
| InChI | InChI=1S/C4H13N3/c1-2-7-3-4(5)6/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | SPGHPHFQNQIZME-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.17 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|