About methyl 11,12-bis(methylsulfanyl)octadecanoate
methyl 11,12-bis(methylsulfanyl)octadecanoate (PubChem CID 14029815) has the molecular formula C21H42O2S2
and a molecular weight of 390.70 g/mol. Its IUPAC name is methyl 11,12-bis(methylsulfanyl)octadecanoate.
Molecular Properties
| Compound Name | methyl 11,12-bis(methylsulfanyl)octadecanoate |
| PubChem CID | 14029815 |
| Molecular Formula | C21H42O2S2 |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | methyl 11,12-bis(methylsulfanyl)octadecanoate |
| SMILES | CCCCCCC(SC)C(CCCCCCCCCC(=O)OC)SC |
| InChI | InChI=1S/C21H42O2S2/c1-5-6-7-13-16-19(24-3)20(25-4)17-14-11-9-8-10-12-15-18-21(22)23-2/h19-20H,5-18H2,1-4H3 |
| InChIKey | NIEZOQSVLPEKEK-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 11,12-bis(methylsulfanyl)octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 11,12-bis(methylsulfanyl)octadecanoate?
The IUPAC name of methyl 11,12-bis(methylsulfanyl)octadecanoate (CID 14029815) is methyl 11,12-bis(methylsulfanyl)octadecanoate.
What is the SMILES notation for methyl 11,12-bis(methylsulfanyl)octadecanoate?
The canonical SMILES for methyl 11,12-bis(methylsulfanyl)octadecanoate is CCCCCCC(SC)C(CCCCCCCCCC(=O)OC)SC.
What is the InChIKey of methyl 11,12-bis(methylsulfanyl)octadecanoate?
The InChIKey is NIEZOQSVLPEKEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O2S2/c1-5-6-7-13-16-19(24-3)20(25-4)17-14-11-9-8-10-12-15-18-21(22)23-2/h19-20H,5-18H2,1-4H3.
What are the key properties of methyl 11,12-bis(methylsulfanyl)octadecanoate?
methyl 11,12-bis(methylsulfanyl)octadecanoate has a molecular weight of 390.70 g/mol, XLogP of 7.10, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 11,12-bis(methylsulfanyl)octadecanoate is sourced from PubChem (CID 14029815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).