About barium(2+);bis(2-nonylphenolate)
barium(2+);bis(2-nonylphenolate) (PubChem CID 14029936) has the molecular formula C30H46BaO2
and a molecular weight of 576.02 g/mol. Its IUPAC name is barium(2+);bis(2-nonylphenolate).
Molecular Properties
| Compound Name | barium(2+);bis(2-nonylphenolate) |
| PubChem CID | 14029936 |
| Molecular Formula | C30H46BaO2 |
| Molecular Weight | 576.02 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | barium(2+);bis(2-nonylphenolate) |
| SMILES | CCCCCCCCCc1ccccc1[O-].CCCCCCCCCc1ccccc1[O-].[Ba+2] |
| InChI | InChI=1S/2C15H24O.Ba/c2*1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;/h2*9-10,12-13,16H,2-8,11H2,1H3;/q;;+2/p-2 |
| InChIKey | SBMJKCDBJMFHGS-UHFFFAOYSA-L |
| XLogP | 7.73 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.02 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(2-nonylphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-nonylphenolate)?
The IUPAC name of barium(2+);bis(2-nonylphenolate) (CID 14029936) is barium(2+);bis(2-nonylphenolate).
What is the SMILES notation for barium(2+);bis(2-nonylphenolate)?
The canonical SMILES for barium(2+);bis(2-nonylphenolate) is CCCCCCCCCc1ccccc1[O-].CCCCCCCCCc1ccccc1[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(2-nonylphenolate)?
The InChIKey is SBMJKCDBJMFHGS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C15H24O.Ba/c2*1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;/h2*9-10,12-13,16H,2-8,11H2,1H3;/q;;+2/p-2.
What are the key properties of barium(2+);bis(2-nonylphenolate)?
barium(2+);bis(2-nonylphenolate) has a molecular weight of 576.02 g/mol, XLogP of 7.73, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-nonylphenolate) is sourced from PubChem (CID 14029936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).