C11H18ClN5O2S — CID 14031328
ethyl [[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-ethylamino]sulfanylformate (PubChem CID 14031328) has the molecular formula C11H18ClN5O2S and a molecular weight of 319.82 g/mol. Its IUPAC name is ethyl [[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-ethylamino]sulfanylformate.
| Compound Name | ethyl [[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-ethylamino]sulfanylformate |
|---|---|
| PubChem CID | 14031328 |
| Molecular Formula | C11H18ClN5O2S |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl [[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-ethylamino]sulfanylformate |
| SMILES | CCOC(=O)SN(CC)c1nc(Cl)nc(NC(C)C)n1 |
| InChI | InChI=1S/C11H18ClN5O2S/c1-5-17(20-11(18)19-6-2)10-15-8(12)14-9(16-10)13-7(3)4/h7H,5-6H2,1-4H3,(H,13,14,15,16) |
| InChIKey | WLBCXSPPPKAYSK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|