About 3-methyl-2,5-diphenyl-2H-1,3-oxazole
3-methyl-2,5-diphenyl-2H-1,3-oxazole (PubChem CID 14031387) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-methyl-2,5-diphenyl-2H-1,3-oxazole.
Molecular Properties
| Compound Name | 3-methyl-2,5-diphenyl-2H-1,3-oxazole |
| PubChem CID | 14031387 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-methyl-2,5-diphenyl-2H-1,3-oxazole |
| SMILES | CN1C=C(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-17-12-15(13-8-4-2-5-9-13)18-16(17)14-10-6-3-7-11-14/h2-12,16H,1H3 |
| InChIKey | OJJMDHYTCUHWCT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2,5-diphenyl-2H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,5-diphenyl-2H-1,3-oxazole?
The IUPAC name of 3-methyl-2,5-diphenyl-2H-1,3-oxazole (CID 14031387) is 3-methyl-2,5-diphenyl-2H-1,3-oxazole.
What is the SMILES notation for 3-methyl-2,5-diphenyl-2H-1,3-oxazole?
The canonical SMILES for 3-methyl-2,5-diphenyl-2H-1,3-oxazole is CN1C=C(c2ccccc2)OC1c1ccccc1.
What is the InChIKey of 3-methyl-2,5-diphenyl-2H-1,3-oxazole?
The InChIKey is OJJMDHYTCUHWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO/c1-17-12-15(13-8-4-2-5-9-13)18-16(17)14-10-6-3-7-11-14/h2-12,16H,1H3.
What are the key properties of 3-methyl-2,5-diphenyl-2H-1,3-oxazole?
3-methyl-2,5-diphenyl-2H-1,3-oxazole has a molecular weight of 237.30 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,5-diphenyl-2H-1,3-oxazole is sourced from PubChem (CID 14031387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).