C15H12F4O6 — CID 1403146
(7S)-7-hydroxy-4,9-dimethoxy-7-(1,1,2,2-tetrafluoroethyl)-6H-furo[3,2-g]chromen-5-one (PubChem CID 1403146) has the molecular formula C15H12F4O6 and a molecular weight of 364.25 g/mol. Its IUPAC name is (7S)-7-hydroxy-4,9-dimethoxy-7-(1,1,2,2-tetrafluoroethyl)-6H-furo[3,2-g]chromen-5-one.
| Compound Name | (7S)-7-hydroxy-4,9-dimethoxy-7-(1,1,2,2-tetrafluoroethyl)-6H-furo[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 1403146 |
| Molecular Formula | C15H12F4O6 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (7S)-7-hydroxy-4,9-dimethoxy-7-(1,1,2,2-tetrafluoroethyl)-6H-furo[3,2-g]chromen-5-one |
| SMILES | COc1c2c(c(OC)c3occc13)O[C@](O)(C(F)(F)C(F)F)CC2=O |
| InChI | InChI=1S/C15H12F4O6/c1-22-9-6-3-4-24-10(6)12(23-2)11-8(9)7(20)5-14(21,25-11)15(18,19)13(16)17/h3-4,13,21H,5H2,1-2H3/t14-/m0/s1 |
| InChIKey | KTXTWPVUDSUHEE-AWEZNQCLSA-N |
| XLogP | 3.00 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|