C8H17NO — CID 14033272
(4S)-4-amino-6-methylhept-1-en-3-ol (PubChem CID 14033272) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (4S)-4-amino-6-methylhept-1-en-3-ol.
| Compound Name | (4S)-4-amino-6-methylhept-1-en-3-ol |
|---|---|
| PubChem CID | 14033272 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (4S)-4-amino-6-methylhept-1-en-3-ol |
| SMILES | C=CC(O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C8H17NO/c1-4-8(10)7(9)5-6(2)3/h4,6-8,10H,1,5,9H2,2-3H3/t7-,8?/m0/s1 |
| InChIKey | ZLIBGPHNVLZNQS-JAMMHHFISA-N |
| XLogP | 0.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|