C17H20O8 — CID 14033843
(7-acetyloxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate (PubChem CID 14033843) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is (7-acetyloxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate.
| Compound Name | (7-acetyloxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate |
|---|---|
| PubChem CID | 14033843 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (7-acetyloxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate |
| SMILES | CC(=O)OC1C(O)OC2COC(c3ccccc3)OC2C1OC(C)=O |
| InChI | InChI=1S/C17H20O8/c1-9(18)22-14-13-12(24-16(20)15(14)23-10(2)19)8-21-17(25-13)11-6-4-3-5-7-11/h3-7,12-17,20H,8H2,1-2H3 |
| InChIKey | KKOAVLPXWRWNHA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |