C20H28O7 — CID 14034006
methyl (3R,4S,5R)-4-hydroxy-3,5-bis[[(E)-3-methylpent-2-enoyl]oxy]cyclohexene-1-carboxylate (PubChem CID 14034006) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl (3R,4S,5R)-4-hydroxy-3,5-bis[[(E)-3-methylpent-2-enoyl]oxy]cyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-4-hydroxy-3,5-bis[[(E)-3-methylpent-2-enoyl]oxy]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 14034006 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl (3R,4S,5R)-4-hydroxy-3,5-bis[[(E)-3-methylpent-2-enoyl]oxy]cyclohexene-1-carboxylate |
| SMILES | CC/C(C)=C/C(=O)O[C@@H]1C=C(C(=O)OC)C[C@@H](OC(=O)/C=C(\C)CC)[C@@H]1O |
| InChI | InChI=1S/C20H28O7/c1-6-12(3)8-17(21)26-15-10-14(20(24)25-5)11-16(19(15)23)27-18(22)9-13(4)7-2/h8-10,15-16,19,23H,6-7,11H2,1-5H3/b12-8+,13-9+/t15-,16-,19-/m1/s1 |
| InChIKey | DNOICGYKMBYMBW-VVIKSDSVSA-N |
| XLogP | 2.39 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|