C13H11NO4 — CID 14035068
(1R,2S,6R,8R)-5-phenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one (PubChem CID 14035068) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (1R,2S,6R,8R)-5-phenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one.
| Compound Name | (1R,2S,6R,8R)-5-phenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one |
|---|---|
| PubChem CID | 14035068 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (1R,2S,6R,8R)-5-phenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one |
| SMILES | O=C1[C@@H]2OC[C@@H](O2)[C@H]2ON=C(c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C13H11NO4/c15-11-9-10(7-4-2-1-3-5-7)14-18-12(9)8-6-16-13(11)17-8/h1-5,8-9,12-13H,6H2/t8-,9+,12-,13-/m1/s1 |
| InChIKey | BBOVXCKFQJIUTP-OTMMVIPVSA-N |
| XLogP | 0.73 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |