C19H17NO4 — CID 14035070
(1R,2S,5S,6R,8R)-4,5-diphenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undecan-7-one (PubChem CID 14035070) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (1R,2S,5S,6R,8R)-4,5-diphenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undecan-7-one.
| Compound Name | (1R,2S,5S,6R,8R)-4,5-diphenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undecan-7-one |
|---|---|
| PubChem CID | 14035070 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (1R,2S,5S,6R,8R)-4,5-diphenyl-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undecan-7-one |
| SMILES | O=C1[C@@H]2OC[C@@H](O2)[C@H]2ON(c3ccccc3)[C@H](c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C19H17NO4/c21-17-15-16(12-7-3-1-4-8-12)20(13-9-5-2-6-10-13)24-18(15)14-11-22-19(17)23-14/h1-10,14-16,18-19H,11H2/t14-,15+,16-,18-,19-/m1/s1 |
| InChIKey | ORVDWONBBAPUAB-LMCLKVLCSA-N |
| XLogP | 2.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |